C17H15N3O3 — CID 155113907
5-[1-(1,3-benzodioxol-5-ylamino)ethenylamino]-1,3-dihydroindol-2-one (PubChem CID 155113907) has the molecular formula C17H15N3O3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-[1-(1,3-benzodioxol-5-ylamino)ethenylamino]-1,3-dihydroindol-2-one.
| Compound Name | 5-[1-(1,3-benzodioxol-5-ylamino)ethenylamino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 155113907 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 5-[1-(1,3-benzodioxol-5-ylamino)ethenylamino]-1,3-dihydroindol-2-one |
| SMILES | C=C(Nc1ccc2c(c1)CC(=O)N2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H15N3O3/c1-10(19-13-3-5-15-16(8-13)23-9-22-15)18-12-2-4-14-11(6-12)7-17(21)20-14/h2-6,8,18-19H,1,7,9H2,(H,20,21) |
| InChIKey | VXSGIJLKOCYZMV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |