C13H14N2O4 — CID 115163929
2,2-dimethyl-3-oxo-3-[(2-oxo-1,3-dihydroindol-5-yl)amino]propanoic acid (PubChem CID 115163929) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-oxo-3-[(2-oxo-1,3-dihydroindol-5-yl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-oxo-3-[(2-oxo-1,3-dihydroindol-5-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 115163929 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2,2-dimethyl-3-oxo-3-[(2-oxo-1,3-dihydroindol-5-yl)amino]propanoic acid |
| SMILES | CC(C)(C(=O)O)C(=O)Nc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H14N2O4/c1-13(2,12(18)19)11(17)14-8-3-4-9-7(5-8)6-10(16)15-9/h3-5H,6H2,1-2H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | STLOWCAXNONERI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|