C10H11NO2 — CID 22131131
5-(2-hydroxyethyl)-1,3-dihydroindol-2-one (PubChem CID 22131131) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-hydroxyethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 22131131 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 5-(2-hydroxyethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCO)ccc2N1 |
| InChI | InChI=1S/C10H11NO2/c12-4-3-7-1-2-9-8(5-7)6-10(13)11-9/h1-2,5,12H,3-4,6H2,(H,11,13) |
| InChIKey | NSIAEJJQCOKBLX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |