C12H11F2NO3 — CID 116839750
2,2-difluoro-4-(2-oxo-1,3-dihydroindol-5-yl)butanoic acid (PubChem CID 116839750) has the molecular formula C12H11F2NO3 and a molecular weight of 255.22 g/mol. Its IUPAC name is 2,2-difluoro-4-(2-oxo-1,3-dihydroindol-5-yl)butanoic acid.
| Compound Name | 2,2-difluoro-4-(2-oxo-1,3-dihydroindol-5-yl)butanoic acid |
|---|---|
| PubChem CID | 116839750 |
| Molecular Formula | C12H11F2NO3 |
| Molecular Weight | 255.22 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2,2-difluoro-4-(2-oxo-1,3-dihydroindol-5-yl)butanoic acid |
| SMILES | O=C1Cc2cc(CCC(F)(F)C(=O)O)ccc2N1 |
| InChI | InChI=1S/C12H11F2NO3/c13-12(14,11(17)18)4-3-7-1-2-9-8(5-7)6-10(16)15-9/h1-2,5H,3-4,6H2,(H,15,16)(H,17,18) |
| InChIKey | VNQGDJQEUBWQHT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |