C9H11N2O+ — CID 25324745
(2-oxo-1,3-dihydroindol-5-yl)methylazanium (PubChem CID 25324745) has the molecular formula C9H11N2O+ and a molecular weight of 163.20 g/mol. Its IUPAC name is (2-oxo-1,3-dihydroindol-5-yl)methylazanium.
| Compound Name | (2-oxo-1,3-dihydroindol-5-yl)methylazanium |
|---|---|
| PubChem CID | 25324745 |
| Molecular Formula | C9H11N2O+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.09 |
| IUPAC Name | (2-oxo-1,3-dihydroindol-5-yl)methylazanium |
| SMILES | [NH3+]Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C9H10N2O/c10-5-6-1-2-8-7(3-6)4-9(12)11-8/h1-3H,4-5,10H2,(H,11,12)/p+1 |
| InChIKey | YRYLTTPCTDJAMT-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 56.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |