C11H14N2O2 — CID 82470284
5-[(2-hydroxyethylamino)methyl]-1,3-dihydroindol-2-one (PubChem CID 82470284) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-[(2-hydroxyethylamino)methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(2-hydroxyethylamino)methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82470284 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-[(2-hydroxyethylamino)methyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CNCCO)ccc2N1 |
| InChI | InChI=1S/C11H14N2O2/c14-4-3-12-7-8-1-2-10-9(5-8)6-11(15)13-10/h1-2,5,12,14H,3-4,6-7H2,(H,13,15) |
| InChIKey | SNCUYPDXRSNEEU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|