C14H18N2O3 — CID 115219921
3-methyl-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid (PubChem CID 115219921) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-methyl-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid.
| Compound Name | 3-methyl-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 115219921 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-methyl-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid |
| SMILES | CC(CNCc1ccc2c(c1)CC(=O)N2)CC(=O)O |
| InChI | InChI=1S/C14H18N2O3/c1-9(4-14(18)19)7-15-8-10-2-3-12-11(5-10)6-13(17)16-12/h2-3,5,9,15H,4,6-8H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | RGWDDLJHGVPKFV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |