C13H14N2O4 — CID 82501019
4-oxo-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid (PubChem CID 82501019) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-oxo-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid.
| Compound Name | 4-oxo-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 82501019 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-oxo-4-[(2-oxo-1,3-dihydroindol-5-yl)methylamino]butanoic acid |
| SMILES | O=C(O)CCC(=O)NCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H14N2O4/c16-11(3-4-13(18)19)14-7-8-1-2-10-9(5-8)6-12(17)15-10/h1-2,5H,3-4,6-7H2,(H,14,16)(H,15,17)(H,18,19) |
| InChIKey | GOJRKEQFPJBATF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |