C18H18N2O2 — CID 110781303
3,4-dimethyl-N-[(2-oxo-1,3-dihydroindol-5-yl)methyl]benzamide (PubChem CID 110781303) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(2-oxo-1,3-dihydroindol-5-yl)methyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[(2-oxo-1,3-dihydroindol-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110781303 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3,4-dimethyl-N-[(2-oxo-1,3-dihydroindol-5-yl)methyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc3c(c2)CC(=O)N3)cc1C |
| InChI | InChI=1S/C18H18N2O2/c1-11-3-5-14(7-12(11)2)18(22)19-10-13-4-6-16-15(8-13)9-17(21)20-16/h3-8H,9-10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | ZSVIXKUQRKMYPO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |