C17H15FN2O2 — CID 110781545
4-fluoro-N-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]benzamide (PubChem CID 110781545) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is 4-fluoro-N-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110781545 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-fluoro-N-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]benzamide |
| SMILES | O=C1CCc2cc(CNC(=O)c3ccc(F)cc3)ccc2N1 |
| InChI | InChI=1S/C17H15FN2O2/c18-14-5-2-12(3-6-14)17(22)19-10-11-1-7-15-13(9-11)4-8-16(21)20-15/h1-3,5-7,9H,4,8,10H2,(H,19,22)(H,20,21) |
| InChIKey | NLKFZAFHNYXIBA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |