C12H13N3O3 — CID 115191821
N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]oxamide (PubChem CID 115191821) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]oxamide.
| Compound Name | N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]oxamide |
|---|---|
| PubChem CID | 115191821 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N'-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]oxamide |
| SMILES | NC(=O)C(=O)NCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H13N3O3/c13-11(17)12(18)14-6-7-1-3-9-8(5-7)2-4-10(16)15-9/h1,3,5H,2,4,6H2,(H2,13,17)(H,14,18)(H,15,16) |
| InChIKey | VMZHZPRSFAXMNI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|