C14H19N3O2 — CID 110775002
1-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-3-propylurea (PubChem CID 110775002) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-3-propylurea.
| Compound Name | 1-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-3-propylurea |
|---|---|
| PubChem CID | 110775002 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]-3-propylurea |
| SMILES | CCCNC(=O)NCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H19N3O2/c1-2-7-15-14(19)16-9-10-3-5-12-11(8-10)4-6-13(18)17-12/h3,5,8H,2,4,6-7,9H2,1H3,(H,17,18)(H2,15,16,19) |
| InChIKey | JSEXRQFICSBKSV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |