C18H19N3O2 — CID 110775001
1-benzyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]urea (PubChem CID 110775001) has the molecular formula C18H19N3O2 and a molecular weight of 309.37 g/mol. Its IUPAC name is 1-benzyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]urea.
| Compound Name | 1-benzyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]urea |
|---|---|
| PubChem CID | 110775001 |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 1-benzyl-3-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methyl]urea |
| SMILES | O=C1CCc2cc(CNC(=O)NCc3ccccc3)ccc2N1 |
| InChI | InChI=1S/C18H19N3O2/c22-17-9-7-15-10-14(6-8-16(15)21-17)12-20-18(23)19-11-13-4-2-1-3-5-13/h1-6,8,10H,7,9,11-12H2,(H,21,22)(H2,19,20,23) |
| InChIKey | MONJBUTUWSMYEC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |