C21H24N4O2 — CID 110640813
N-benzyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperazine-1-carboxamide (PubChem CID 110640813) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-benzyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperazine-1-carboxamide.
| Compound Name | N-benzyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110640813 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-benzyl-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)piperazine-1-carboxamide |
| SMILES | O=C1CCc2cc(N3CCN(C(=O)NCc4ccccc4)CC3)ccc2N1 |
| InChI | InChI=1S/C21H24N4O2/c26-20-9-6-17-14-18(7-8-19(17)23-20)24-10-12-25(13-11-24)21(27)22-15-16-4-2-1-3-5-16/h1-5,7-8,14H,6,9-13,15H2,(H,22,27)(H,23,26) |
| InChIKey | XAMGJQLYLHPXDO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|