C20H20ClN3O2 — CID 13236324
6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 13236324) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13236324 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 6-[4-(3-chlorobenzoyl)piperazin-1-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(N3CCN(C(=O)c4cccc(Cl)c4)CC3)ccc2N1 |
| InChI | InChI=1S/C20H20ClN3O2/c21-16-3-1-2-15(12-16)20(26)24-10-8-23(9-11-24)17-5-6-18-14(13-17)4-7-19(25)22-18/h1-3,5-6,12-13H,4,7-11H2,(H,22,25) |
| InChIKey | ASIOBLGSDPEUMZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|