C23H28ClN3O — CID 13084721
6-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 13084721) has the molecular formula C23H28ClN3O and a molecular weight of 397.95 g/mol. Its IUPAC name is 6-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 13084721 |
| Molecular Formula | C23H28ClN3O |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 6-[4-[4-(3-chlorophenyl)piperazin-1-yl]butyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CCCCN3CCN(c4cccc(Cl)c4)CC3)ccc2N1 |
| InChI | InChI=1S/C23H28ClN3O/c24-20-5-3-6-21(17-20)27-14-12-26(13-15-27)11-2-1-4-18-7-9-22-19(16-18)8-10-23(28)25-22/h3,5-7,9,16-17H,1-2,4,8,10-15H2,(H,25,28) |
| InChIKey | GXKHGUASZBXVLE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|