C14H16N2O3 — CID 115175903
2-oxo-N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]propanamide (PubChem CID 115175903) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-oxo-N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]propanamide.
| Compound Name | 2-oxo-N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 115175903 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-oxo-N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]propanamide |
| SMILES | CC(=O)C(=O)NCCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H16N2O3/c1-9(17)14(19)15-7-6-10-2-4-12-11(8-10)3-5-13(18)16-12/h2,4,8H,3,5-7H2,1H3,(H,15,19)(H,16,18) |
| InChIKey | VRGCAPDRZTXFIT-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|