C20H22N2O3 — CID 110788637
N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]-3-phenoxypropanamide (PubChem CID 110788637) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]-3-phenoxypropanamide.
| Compound Name | N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 110788637 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethyl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)NCCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C20H22N2O3/c23-19(11-13-25-17-4-2-1-3-5-17)21-12-10-15-6-8-18-16(14-15)7-9-20(24)22-18/h1-6,8,14H,7,9-13H2,(H,21,23)(H,22,24) |
| InChIKey | KAJVBZKHUUCKCJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |