C11H13NOS — CID 82283516
6-(2-sulfanylethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82283516) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 6-(2-sulfanylethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-sulfanylethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82283516 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 6-(2-sulfanylethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CCS)ccc2N1 |
| InChI | InChI=1S/C11H13NOS/c13-11-4-2-9-7-8(5-6-14)1-3-10(9)12-11/h1,3,7,14H,2,4-6H2,(H,12,13) |
| InChIKey | TURXAGKJTARMPV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|