C11H12ClNO3S — CID 82488863
2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonyl chloride (PubChem CID 82488863) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonyl chloride.
| Compound Name | 2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 82488863 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)ethanesulfonyl chloride |
| SMILES | O=C1CCc2cc(CCS(=O)(=O)Cl)ccc2N1 |
| InChI | InChI=1S/C11H12ClNO3S/c12-17(15,16)6-5-8-1-3-10-9(7-8)2-4-11(14)13-10/h1,3,7H,2,4-6H2,(H,13,14) |
| InChIKey | GKRIOIUVJPUIQP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |