C14H15NO3 — CID 116865917
(E)-5-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pent-2-enoic acid (PubChem CID 116865917) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is (E)-5-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pent-2-enoic acid.
| Compound Name | (E)-5-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pent-2-enoic acid |
|---|---|
| PubChem CID | 116865917 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | (E)-5-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)pent-2-enoic acid |
| SMILES | O=C(O)/C=C/CCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H15NO3/c16-13-8-6-11-9-10(5-7-12(11)15-13)3-1-2-4-14(17)18/h2,4-5,7,9H,1,3,6,8H2,(H,15,16)(H,17,18)/b4-2+ |
| InChIKey | DYGAFHJGLGYEGW-DUXPYHPUSA-N |
| XLogP | 2.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|