C13H16N2O3 — CID 82480198
3-amino-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanoic acid (PubChem CID 82480198) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-amino-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanoic acid.
| Compound Name | 3-amino-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanoic acid |
|---|---|
| PubChem CID | 82480198 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 3-amino-4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)butanoic acid |
| SMILES | NC(CC(=O)O)Cc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C13H16N2O3/c14-10(7-13(17)18)6-8-1-3-11-9(5-8)2-4-12(16)15-11/h1,3,5,10H,2,4,6-7,14H2,(H,15,16)(H,17,18) |
| InChIKey | YWBFNLSVTHILII-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |