C14H21N3O2 — CID 115120823
6-[2-[(2-amino-3-hydroxypropyl)amino]ethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 115120823) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-[2-[(2-amino-3-hydroxypropyl)amino]ethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-[(2-amino-3-hydroxypropyl)amino]ethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 115120823 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 6-[2-[(2-amino-3-hydroxypropyl)amino]ethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC(CO)CNCCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C14H21N3O2/c15-12(9-18)8-16-6-5-10-1-3-13-11(7-10)2-4-14(19)17-13/h1,3,7,12,16,18H,2,4-6,8-9,15H2,(H,17,19) |
| InChIKey | DNCTVWADBIELCZ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|