C12H16N2O — CID 82282846
6-[2-(methylamino)ethyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 82282846) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-[2-(methylamino)ethyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[2-(methylamino)ethyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 82282846 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 6-[2-(methylamino)ethyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CNCCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c1-13-7-6-9-2-4-11-10(8-9)3-5-12(15)14-11/h2,4,8,13H,3,5-7H2,1H3,(H,14,15) |
| InChIKey | BRPWKYAEHPYMLH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |