C11H12BrNO — CID 18382037
6-(2-bromoethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 18382037) has the molecular formula C11H12BrNO and a molecular weight of 254.13 g/mol. Its IUPAC name is 6-(2-bromoethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(2-bromoethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 18382037 |
| Molecular Formula | C11H12BrNO |
| Molecular Weight | 254.13 g/mol |
| Exact Mass | 253.01 |
| IUPAC Name | 6-(2-bromoethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CCBr)ccc2N1 |
| InChI | InChI=1S/C11H12BrNO/c12-6-5-8-1-3-10-9(7-8)2-4-11(14)13-10/h1,3,7H,2,4-6H2,(H,13,14) |
| InChIKey | MGXQGJMSINCVLV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.13 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|