C11H14N2OS — CID 115227915
6-[(sulfanylmethylamino)methyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 115227915) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 6-[(sulfanylmethylamino)methyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(sulfanylmethylamino)methyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 115227915 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 6-[(sulfanylmethylamino)methyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(CNCS)ccc2N1 |
| InChI | InChI=1S/C11H14N2OS/c14-11-4-2-9-5-8(6-12-7-15)1-3-10(9)13-11/h1,3,5,12,15H,2,4,6-7H2,(H,13,14) |
| InChIKey | MGPAJOHOPDDCJP-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|