C12H13N3O — CID 115130975
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methylamino]acetonitrile (PubChem CID 115130975) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methylamino]acetonitrile.
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methylamino]acetonitrile |
|---|---|
| PubChem CID | 115130975 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)methylamino]acetonitrile |
| SMILES | N#CCNCc1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C12H13N3O/c13-5-6-14-8-9-1-3-11-10(7-9)2-4-12(16)15-11/h1,3,7,14H,2,4,6,8H2,(H,15,16) |
| InChIKey | WDFNFOHZKUWEGM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|