C14H19N3O — CID 115207779
5-[2-(azetidin-3-ylmethylamino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 115207779) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[2-(azetidin-3-ylmethylamino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(azetidin-3-ylmethylamino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115207779 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[2-(azetidin-3-ylmethylamino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCNCC3CNC3)ccc2N1 |
| InChI | InChI=1S/C14H19N3O/c18-14-6-12-5-10(1-2-13(12)17-14)3-4-15-7-11-8-16-9-11/h1-2,5,11,15-16H,3-4,6-9H2,(H,17,18) |
| InChIKey | YLQKSNJQGULWTC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|