C11H16N4O — CID 115261107
5-[2-(hydrazinylmethylamino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 115261107) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 5-[2-(hydrazinylmethylamino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(hydrazinylmethylamino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115261107 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-[2-(hydrazinylmethylamino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | NNCNCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H16N4O/c12-14-7-13-4-3-8-1-2-10-9(5-8)6-11(16)15-10/h1-2,5,13-14H,3-4,6-7,12H2,(H,15,16) |
| InChIKey | XUVAKOYNNOXALX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|