C15H21N3O — CID 115208383
5-[2-(pyrrolidin-2-ylmethylamino)ethyl]-1,3-dihydroindol-2-one (PubChem CID 115208383) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-[2-(pyrrolidin-2-ylmethylamino)ethyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[2-(pyrrolidin-2-ylmethylamino)ethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115208383 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 5-[2-(pyrrolidin-2-ylmethylamino)ethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCNCC3CCCN3)ccc2N1 |
| InChI | InChI=1S/C15H21N3O/c19-15-9-12-8-11(3-4-14(12)18-15)5-7-16-10-13-2-1-6-17-13/h3-4,8,13,16-17H,1-2,5-7,9-10H2,(H,18,19) |
| InChIKey | RQEKKJJXMNEFEH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|