C14H19N3O3S — CID 104972452
2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-dihydroindole-5-sulfonamide (PubChem CID 104972452) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-dihydroindole-5-sulfonamide.
| Compound Name | 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 104972452 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-oxo-N-[2-[(2R)-pyrrolidin-2-yl]ethyl]-1,3-dihydroindole-5-sulfonamide |
| SMILES | O=C1Cc2cc(S(=O)(=O)NCC[C@H]3CCCN3)ccc2N1 |
| InChI | InChI=1S/C14H19N3O3S/c18-14-9-10-8-12(3-4-13(10)17-14)21(19,20)16-7-5-11-2-1-6-15-11/h3-4,8,11,15-16H,1-2,5-7,9H2,(H,17,18)/t11-/m1/s1 |
| InChIKey | HTTVWHGQXMWQDM-LLVKDONJSA-N |
| XLogP | 0.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |