C16H22N2O — CID 98016927
5-[3-(cyclopentylamino)propyl]-1,3-dihydroindol-2-one (PubChem CID 98016927) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 5-[3-(cyclopentylamino)propyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[3-(cyclopentylamino)propyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 98016927 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 5-[3-(cyclopentylamino)propyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCCNC3CCCC3)ccc2N1 |
| InChI | InChI=1S/C16H22N2O/c19-16-11-13-10-12(7-8-15(13)18-16)4-3-9-17-14-5-1-2-6-14/h7-8,10,14,17H,1-6,9,11H2,(H,18,19) |
| InChIKey | IZIQJDBDLKSRGS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|