C21H31N3O2 — CID 119620576
N-[2-(cycloheptylamino)ethyl]-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide (PubChem CID 119620576) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is N-[2-(cycloheptylamino)ethyl]-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide.
| Compound Name | N-[2-(cycloheptylamino)ethyl]-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
|---|---|
| PubChem CID | 119620576 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | N-[2-(cycloheptylamino)ethyl]-4-(2-oxo-1,3-dihydroindol-5-yl)butanamide |
| SMILES | O=C(CCCc1ccc2c(c1)CC(=O)N2)NCCNC1CCCCCC1 |
| InChI | InChI=1S/C21H31N3O2/c25-20(23-13-12-22-18-7-3-1-2-4-8-18)9-5-6-16-10-11-19-17(14-16)15-21(26)24-19/h10-11,14,18,22H,1-9,12-13,15H2,(H,23,25)(H,24,26) |
| InChIKey | HSFCTKODQVZYID-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|