C12H14N2O2 — CID 115223207
2-[2-(2-oxo-1,3-dihydroindol-5-yl)ethylamino]acetaldehyde (PubChem CID 115223207) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 2-[2-(2-oxo-1,3-dihydroindol-5-yl)ethylamino]acetaldehyde.
| Compound Name | 2-[2-(2-oxo-1,3-dihydroindol-5-yl)ethylamino]acetaldehyde |
|---|---|
| PubChem CID | 115223207 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2-[2-(2-oxo-1,3-dihydroindol-5-yl)ethylamino]acetaldehyde |
| SMILES | O=CCNCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H14N2O2/c15-6-5-13-4-3-9-1-2-11-10(7-9)8-12(16)14-11/h1-2,6-7,13H,3-5,8H2,(H,14,16) |
| InChIKey | CXHPGFCDATZALD-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|