C12H11N3O2 — CID 115172488
1-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]formamide (PubChem CID 115172488) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 1-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]formamide.
| Compound Name | 1-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]formamide |
|---|---|
| PubChem CID | 115172488 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 1-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]formamide |
| SMILES | N#CC(=O)NCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H11N3O2/c13-7-12(17)14-4-3-8-1-2-10-9(5-8)6-11(16)15-10/h1-2,5H,3-4,6H2,(H,14,17)(H,15,16) |
| InChIKey | KKCNONKHBTWYSC-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|