About 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide
3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide (PubChem CID 115173941) has the molecular formula C14H15N3O2
and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide.
Molecular Properties
| Compound Name | 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide |
| PubChem CID | 115173941 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide |
| SMILES | N#CCCC(=O)NCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C14H15N3O2/c15-6-1-2-13(18)16-7-5-10-3-4-12-11(8-10)9-14(19)17-12/h3-4,8H,1-2,5,7,9H2,(H,16,18)(H,17,19) |
| InChIKey | UQHRZAGDIRPECR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide?
The IUPAC name of 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide (CID 115173941) is 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide.
What is the SMILES notation for 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide?
The canonical SMILES for 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide is N#CCCC(=O)NCCc1ccc2c(c1)CC(=O)N2.
What is the InChIKey of 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide?
The InChIKey is UQHRZAGDIRPECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O2/c15-6-1-2-13(18)16-7-5-10-3-4-12-11(8-10)9-14(19)17-12/h3-4,8H,1-2,5,7,9H2,(H,16,18)(H,17,19).
What are the key properties of 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide?
3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide has a molecular weight of 257.29 g/mol, XLogP of 1.14, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-N-[2-(2-oxo-1,3-dihydroindol-5-yl)ethyl]propanamide is sourced from PubChem (CID 115173941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).