C12H16N2O — CID 82190436
5-(4-aminobutyl)-1,3-dihydroindol-2-one (PubChem CID 82190436) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-(4-aminobutyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-aminobutyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82190436 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-(4-aminobutyl)-1,3-dihydroindol-2-one |
| SMILES | NCCCCc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c13-6-2-1-3-9-4-5-11-10(7-9)8-12(15)14-11/h4-5,7H,1-3,6,8,13H2,(H,14,15) |
| InChIKey | OZUITLSYQJJAKZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|