C11H13BrN2O — CID 115262041
5-[[bromomethyl(methyl)amino]methyl]-1,3-dihydroindol-2-one (PubChem CID 115262041) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-[[bromomethyl(methyl)amino]methyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[[bromomethyl(methyl)amino]methyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115262041 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | 5-[[bromomethyl(methyl)amino]methyl]-1,3-dihydroindol-2-one |
| SMILES | CN(CBr)Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H13BrN2O/c1-14(7-12)6-8-2-3-10-9(4-8)5-11(15)13-10/h2-4H,5-7H2,1H3,(H,13,15) |
| InChIKey | RFYZDQGWPNCGBQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|