C13H14N2O4 — CID 115142468
methyl 2-[methyl-[(2-oxo-1,3-dihydroindol-5-yl)methyl]amino]-2-oxoacetate (PubChem CID 115142468) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 2-[methyl-[(2-oxo-1,3-dihydroindol-5-yl)methyl]amino]-2-oxoacetate.
| Compound Name | methyl 2-[methyl-[(2-oxo-1,3-dihydroindol-5-yl)methyl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 115142468 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 2-[methyl-[(2-oxo-1,3-dihydroindol-5-yl)methyl]amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)N(C)Cc1ccc2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C13H14N2O4/c1-15(12(17)13(18)19-2)7-8-3-4-10-9(5-8)6-11(16)14-10/h3-5H,6-7H2,1-2H3,(H,14,16) |
| InChIKey | PHVXSVOOKOXAOJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|