C21H23NO2 — CID 167644306
2,2-dimethyl-1-(4-phenylbutanoyl)-3H-quinolin-4-one (PubChem CID 167644306) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2,2-dimethyl-1-(4-phenylbutanoyl)-3H-quinolin-4-one.
| Compound Name | 2,2-dimethyl-1-(4-phenylbutanoyl)-3H-quinolin-4-one |
|---|---|
| PubChem CID | 167644306 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 2,2-dimethyl-1-(4-phenylbutanoyl)-3H-quinolin-4-one |
| SMILES | CC1(C)CC(=O)c2ccccc2N1C(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-21(2)15-19(23)17-12-6-7-13-18(17)22(21)20(24)14-8-11-16-9-4-3-5-10-16/h3-7,9-10,12-13H,8,11,14-15H2,1-2H3 |
| InChIKey | PPYKCGXFFDRPEK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |