C14H16N2O3 — CID 110191669
5,5-dimethyl-1-(3-phenylpropanoyl)imidazolidine-2,4-dione (PubChem CID 110191669) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 5,5-dimethyl-1-(3-phenylpropanoyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1-(3-phenylpropanoyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 110191669 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 5,5-dimethyl-1-(3-phenylpropanoyl)imidazolidine-2,4-dione |
| SMILES | CC1(C)C(=O)NC(=O)N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H16N2O3/c1-14(2)12(18)15-13(19)16(14)11(17)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,15,18,19) |
| InChIKey | YPUMLXZYIMFZQW-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|