C17H23NO2 — CID 67737802
(5R)-5-ethyl-3,3-dimethyl-1-(3-phenylpropanoyl)pyrrolidin-2-one (PubChem CID 67737802) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (5R)-5-ethyl-3,3-dimethyl-1-(3-phenylpropanoyl)pyrrolidin-2-one.
| Compound Name | (5R)-5-ethyl-3,3-dimethyl-1-(3-phenylpropanoyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 67737802 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (5R)-5-ethyl-3,3-dimethyl-1-(3-phenylpropanoyl)pyrrolidin-2-one |
| SMILES | CC[C@@H]1CC(C)(C)C(=O)N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C17H23NO2/c1-4-14-12-17(2,3)16(20)18(14)15(19)11-10-13-8-6-5-7-9-13/h5-9,14H,4,10-12H2,1-3H3/t14-/m1/s1 |
| InChIKey | OLOJCNIHDOXIGO-CQSZACIVSA-N |
| XLogP | 3.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |