C13H13NO4 — CID 59119731
(4S)-4-methyl-3-(3-phenylpropanoyl)-1,3-oxazolidine-2,5-dione (PubChem CID 59119731) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (4S)-4-methyl-3-(3-phenylpropanoyl)-1,3-oxazolidine-2,5-dione.
| Compound Name | (4S)-4-methyl-3-(3-phenylpropanoyl)-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 59119731 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (4S)-4-methyl-3-(3-phenylpropanoyl)-1,3-oxazolidine-2,5-dione |
| SMILES | C[C@H]1C(=O)OC(=O)N1C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C13H13NO4/c1-9-12(16)18-13(17)14(9)11(15)8-7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | FEHCOTSYNILORJ-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|