C28H26Cl3NO4 — CID 161425266
3-(4-chlorophenyl)propanoyl chloride;(4R,5S)-3-[3-(4-chlorophenyl)propanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 161425266) has the molecular formula C28H26Cl3NO4 and a molecular weight of 546.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)propanoyl chloride;(4R,5S)-3-[3-(4-chlorophenyl)propanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(4-chlorophenyl)propanoyl chloride;(4R,5S)-3-[3-(4-chlorophenyl)propanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 161425266 |
| Molecular Formula | C28H26Cl3NO4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 3-(4-chlorophenyl)propanoyl chloride;(4R,5S)-3-[3-(4-chlorophenyl)propanoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OC(=O)N1C(=O)CCc1ccc(Cl)cc1.O=C(Cl)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO3.C9H8Cl2O/c1-13-18(15-5-3-2-4-6-15)24-19(23)21(13)17(22)12-9-14-7-10-16(20)11-8-14;10-8-4-1-7(2-5-8)3-6-9(11)12/h2-8,10-11,13,18H,9,12H2,1H3;1-2,4-5H,3,6H2/t13-,18-;/m1./s1 |
| InChIKey | VXGSSKKMURCGRM-QRGZVCNKSA-N |
| XLogP | 7.42 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|