C10H9Cl2NO4 — CID 86120653
methyl 2-[(2,4-dichlorobenzoyl)amino]oxyacetate (PubChem CID 86120653) has the molecular formula C10H9Cl2NO4 and a molecular weight of 278.09 g/mol. Its IUPAC name is methyl 2-[(2,4-dichlorobenzoyl)amino]oxyacetate.
| Compound Name | methyl 2-[(2,4-dichlorobenzoyl)amino]oxyacetate |
|---|---|
| PubChem CID | 86120653 |
| Molecular Formula | C10H9Cl2NO4 |
| Molecular Weight | 278.09 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | methyl 2-[(2,4-dichlorobenzoyl)amino]oxyacetate |
| SMILES | COC(=O)CONC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2NO4/c1-16-9(14)5-17-13-10(15)7-3-2-6(11)4-8(7)12/h2-4H,5H2,1H3,(H,13,15) |
| InChIKey | SHBLTNBSBMHOAN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.09 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|