C10H11Cl2N3O2 — CID 134094710
3-[(2,4-dichlorobenzoyl)amino]-1,1-dimethylurea (PubChem CID 134094710) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 3-[(2,4-dichlorobenzoyl)amino]-1,1-dimethylurea.
| Compound Name | 3-[(2,4-dichlorobenzoyl)amino]-1,1-dimethylurea |
|---|---|
| PubChem CID | 134094710 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 3-[(2,4-dichlorobenzoyl)amino]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O2/c1-15(2)10(17)14-13-9(16)7-4-3-6(11)5-8(7)12/h3-5H,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | QJCIJUWDHQZSIV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|