C14H17Cl2N3O3 — CID 36706576
N-[2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]-2,2-dimethylpropanamide (PubChem CID 36706576) has the molecular formula C14H17Cl2N3O3 and a molecular weight of 346.21 g/mol. Its IUPAC name is N-[2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 36706576 |
| Molecular Formula | C14H17Cl2N3O3 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | N-[2-[2-(2,4-dichlorobenzoyl)hydrazinyl]-2-oxoethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCC(=O)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O3/c1-14(2,3)13(22)17-7-11(20)18-19-12(21)9-5-4-8(15)6-10(9)16/h4-6H,7H2,1-3H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | MFIPRNVEPCZKCF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|