C13H16Cl2N2O2 — CID 175051329
2,4-dichloro-N-[1-(ethylamino)-2-methyl-1-oxopropan-2-yl]benzamide (PubChem CID 175051329) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 2,4-dichloro-N-[1-(ethylamino)-2-methyl-1-oxopropan-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[1-(ethylamino)-2-methyl-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 175051329 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2,4-dichloro-N-[1-(ethylamino)-2-methyl-1-oxopropan-2-yl]benzamide |
| SMILES | CCNC(=O)C(C)(C)NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-4-16-12(19)13(2,3)17-11(18)9-6-5-8(14)7-10(9)15/h5-7H,4H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | SJLMUNORHAONNR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |