C15H13Cl2N3O4 — CID 9472501
2,4-dichloro-N-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 9472501) has the molecular formula C15H13Cl2N3O4 and a molecular weight of 370.19 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 9472501 |
| Molecular Formula | C15H13Cl2N3O4 |
| Molecular Weight | 370.19 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | 2,4-dichloro-N-[2-[2-(2-methylfuran-3-carbonyl)hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | Cc1occc1C(=O)NNC(=O)CNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H13Cl2N3O4/c1-8-10(4-5-24-8)15(23)20-19-13(21)7-18-14(22)11-3-2-9(16)6-12(11)17/h2-6H,7H2,1H3,(H,18,22)(H,19,21)(H,20,23) |
| InChIKey | PPSJWJAXHMKERA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|