C15H13Cl2N3O2S — CID 134103806
1-[(2,4-dichlorobenzoyl)amino]-3-(4-methylsulfanylphenyl)urea (PubChem CID 134103806) has the molecular formula C15H13Cl2N3O2S and a molecular weight of 370.26 g/mol. Its IUPAC name is 1-[(2,4-dichlorobenzoyl)amino]-3-(4-methylsulfanylphenyl)urea.
| Compound Name | 1-[(2,4-dichlorobenzoyl)amino]-3-(4-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 134103806 |
| Molecular Formula | C15H13Cl2N3O2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.01 |
| IUPAC Name | 1-[(2,4-dichlorobenzoyl)amino]-3-(4-methylsulfanylphenyl)urea |
| SMILES | CSc1ccc(NC(=O)NNC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C15H13Cl2N3O2S/c1-23-11-5-3-10(4-6-11)18-15(22)20-19-14(21)12-7-2-9(16)8-13(12)17/h2-8H,1H3,(H,19,21)(H2,18,20,22) |
| InChIKey | UJXTVHATLMUYOW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|